Tellurium Oxide Powder
Product Description
| Product | Tellurium Oxide Powder |
| CAS | 7446-07-3 |
| Formula | O2Te |
| Synonym | tellurium(IV) dioxide, TELLURIUM(IV) OXIDE, TELLURIUM OXIDE, TELLERIUM OXIDE, TELLURIUM(+4)OXIDE, Tellurium oxide (TeO2), telluriumoxide(teo2), Tellurous acid anhydride, TeO2, Tellurium dioxide, Tellurium oxide, Tellurium dioxide, Tellurous acid anhydride |
Typical Product Specifications
| Molecular weight | 159.60 |
| EINECS | 231-193-1 |
| SMILES | [Te](=O)=O |
| InChI | 1S/O2Te/c1-3-2 |
| Density | 5.67 g/mL at 25 °C |
| Boiling Point | 1245 °C |
| Water solubility | insoluble |
| Melting Point | 733 °C |
| Color | White to slightly yellow |
| Storage Temperature | Storage temperature: no restrictions. |
| Stability | Stable. Incompatible with strong acids, strong oxidizing agents. |
| Merck | 14,9123 |
| Form | Powder |
| Molecular weight | 300.74 |
| EINECS | 212-688-1 |
| SMILES | c12C(=NC(C(=O)N(c1ccc(c2)Cl)C)O)c1ccccc1 |
| InChI | 1S/C16H13ClN2O2/c1-19-13-8-7-11(17)9-12(13)14(18-15(20)16(19)21)10-5-3-2-4-6-10/h2-9,15,20H,1H3 |
| Melting Point | 119-121 ° C |
| log P (octanol-water) | 2.19 |
| Atmospheric OH Rate Constant | 1.44E-11 cm3/molecule-sec |
| Henry's Law Constant | 1.13E-08 atm-m3/mole |
| Water solubility | 164 mg/L |
| Vapor Pressure | 2.14E-11 mm Hg |
| Melting Point | 119-121°C |
| Storage Temperature | 2-8°C |
| Flash Point | 11 °C |
| Notes | Tellurium Oxide Powder uses and applications include: Glass ingredient; semiconductor ingredient; metal additive |
| Class | Specialty Chemicals |
| Function | Additive |
Find another Material
Enter a chemical name, synonym or CAS# below
