| Molecular weight | 303.35 |
| EINECS | 200-090-3 |
| SMILES | CN1[C@@H]2C[C@H](C[C@H]1[C@H]3[C@@H]2O3)OC(=O)[C@H](CO)c4ccccc4 |
| Vapor Pressure | 7.18E-09 mm Hg |
| Water solubility | 1.00E+05 mg/L |
| pKa Dissociation Constant | 7.75 |
| log P (octanol-water) | 0.98 |
| Henry's Law Constant | 3.36E-16 atm-m3/mole |
| Melting Point | 59 ° C |
| Molecular weight | 398.29 |
| EINECS | 205-844-5 |
| SMILES | [Br-].C[N+]1(C)[C@@H]2CC(C[C@H]1[C@@H]3O[C@H]23)OC(=O)[C@H](CO)c4ccccc4 |
| log P (octanol-water) | -2.580 |
| Atmospheric OH Rate Constant | 5.50E-11 cm3/molecule-sec |
| Molecular weight | 361.30 |
| EINECS | 200-747-4 |
| SMILES | [N+](CCOC(=O)CCC(=O)OCC[N+](C)(C)C)(C)(C)C.[ClH-].[ClH-] |
| Atmospheric OH Rate Constant | 3.33E-11 cm3/molecule-sec |
| log P (octanol-water) | -7.940 |
| EINECS | 204-858-9 |
| Melting Point | 190 ° C |
| SMILES | Cc1c(noc1NS(=O)(=O)c2ccc(cc2)N)C |
| Water solubility | 5.00E+05 mg/L |
| InChI | 1S/C11H13N3O3S/c1-7-8(2)13-17-11(7)14-18(15,16)10-5-3-9(12)4-6-10/h3-6,14H,12H2,1-2H3 |
| Stability | Stable. Combustible. Incompatible with strong oxidizing agents. |
| InChI | 1S/C17H21NO4/c1-18-13-7-11(8-14(18)16-15(13)22-16)21-17(20)12(9-19)10-5-3-2-4-6-10/h2-6,11-16,19H,7-9H2,1H3/t11-,12?,13?,14?,15-,16+ |
| Stability | Stable. Incompatible with strong oxidizin |
| Water solubility | <0.1 g/100 mL at 22.5 ºC |
| Merck | 13,9041 |
| Melting Point | 195°C |
| Storage Temperature | 2-8°C |
| Melting Point | 191 ° C |
| Vapor Pressure | 5.08E-08 mm Hg |
| log P (octanol-water) | 1.01 |
| Water solubility | 300 mg/L |
| Atmospheric OH Rate Constant | 3.24E-11 cm3/molecule-sec |
| Henry's Law Constant | 1.06E-12 atm-m3/mole |
| Solubility | acetone: complete50 mg/ml |
| Molecular weight | 361.30 |
| EINECS | 200-747-4 |
| SMILES | [N+](CCOC(=O)CCC(=O)OCC[N+](C)(C)C)(C)(C)C.[ClH-].[ClH-] |
| Atmospheric OH Rate Constant | 3.33E-11 cm3/molecule-sec |
| log P (octanol-water) | -7.940 |
| Melting Point | 190 ° C |
| Water solubility | 5.00E+05 mg/L |
| Stability | Stable. Combustible. Incompatible with strong oxidizing agents. |
| Storage Temperature | Refrigerator |
| Melting Point | 164 °C |
| Merck | 8875 |
| Atmospheric OH Rate Constant | 5.97E-11 cm3/molecule-sec |
| Storage Temperature | Refrigerator |
| Melting Point | 164 °C |
| Merck | 8875 |
| Molecular weight | 214.25 |
| EINECS | 200-345-9 |
| SMILES | c1cc(ccc1N)S(=O)(=O)NC(=N)N |
| InChI | 1S/C7H10N4O2S/c8-5-1-3-6(4-2-5)14(12,13)11-7(9)10/h1-4H,8H2,(H4,9,10,11) |
| Atmospheric OH Rate Constant | 4.40E-11 cm3/molecule-sec |
| pKa Dissociation Constant | 11.25 |
| Vapor Pressure | 1.47E-07 mm Hg |
| Melting Point | 191.5 ° C |
| Water solubility | 2200 mg/L |
| log P (octanol-water) | -1.22E+00 |
| Henry's Law Constant | 1.01E-15 atm-m3/mole |
| Solubility | 1 M HCl: soluble50mg/mL |
| Merck | 8908 |
| Stability | Stable. Incompatible with strong oxidizing agents. |
| Water solubility | 1g/1000mL at 25 ºC |
| Melting Point | 190-193°C |
| Storage Temperature | -20°C |
| Color | white to off-white |
| Form | Powder |
| Molecular weight | 280.30 |
| EINECS | 201-272-5 |
| SMILES | c1(S(=O)(=O)Nc2ccc(nn2)OC)ccc(cc1)N |
| InChI | 1S/C11H12N4O3S/c1-18-11-7-6-10(13-14-11)15-19(16,17)9-4-2-8(12)3-5-9/h2-7H,12H2,1H3,(H,13,15) |
| Henry's Law Constant | 2.37E-14 atm-m3/mole |
| Melting Point | 182.5 ° C |
| Water solubility | 147 mg/L |
| log P (octanol-water) | 0.32 |
| Atmospheric OH Rate Constant | 2.82E-11 cm3/molecule-sec |
| pKa Dissociation Constant | 6.7 |
| Vapor Pressure | 5.65E-10 mm Hg |
| Storage Temperature | 2-8°C |
| Form | Crystalline Powder |
| Merck | 13,9004 |
| Color | White to yellow |
| Molecular weight | 214.25 |
| EINECS | 200-345-9 |
| SMILES | c1cc(ccc1N)S(=O)(=O)NC(=N)N |
| InChI | 1S/C7H10N4O2S/c8-5-1-3-6(4-2-5)14(12,13)11-7(9)10/h1-4H,8H2,(H4,9,10,11) |
| Atmospheric OH Rate Constant | 4.40E-11 cm3/molecule-sec |
| pKa Dissociation Constant | 11.25 |
| Vapor Pressure | 1.47E-07 mm Hg |
| Melting Point | 191.5 ° C |
| Water solubility | 2200 mg/L |
| log P (octanol-water) | -1.22E+00 |
| Henry's Law Constant | 1.01E-15 atm-m3/mole |
| Solubility | 1 M HCl: soluble50mg/mL |
| Merck | 8908 |
| Stability | Stable. Incompatible with strong oxidizing agents. |
| Water solubility | 1g/1000mL at 25 ºC |
| Melting Point | 190-193°C |
| Storage Temperature | -20°C |
| Color | white to off-white |
| Form | Powder |
| Molecular weight | 267.30 |
| Class | Specialty Chemicals, Amines |
| Function | Intermediates, Enzyme |
| Industry | Pharmaceutical |
