| EINECS | 240-793-2 |
| Molecular weight | 340.41 |
| EINECS | 216-823-5 |
| SMILES | C(c1ccc(cc1)OCC1CO1)(c1ccc(cc1)OCC1CO1)(C)C |
| InChI | 1S/C21H24O4/c1-21(2,15-3-7-17(8-4-15)22-11-19-13-24-19)16-5-9-18(10-6-16)23-12-20-14-25-20/h3-10,19-20H,11-14H2,1-2H3 |
| Storage Temperature | 2-8°C |
| Water solubility | Soluble in 100% ethanol, dimethyl sulfoxide (100 mM), dimethyl formamide, chloroform, methanol, and ethanol (50 mM). Insoluble in water. |
| Melting Point | 40-44 °C |
| Refractive Index | 1.5735 |
| Molecular weight | 159.27 |
| Boiling Point | 210 °C / 1mmHg |
| Density | 1,17 g/cm3 |
| BRN Number | 299026 |
| Notes | Hexyloxypropylamine uses and applications include: Corrosion inhibitor for metalworking fluids; antistat; additive for fuel, lubricant, petrol. refining; intermediate for surfactants, textile foaming agents, ethoxylates and agriculture chemical; crosslinking agent for epoxy resins
Suggested storage of Hexyloxypropylamine: Store in stainless steel or carbon steel containers |
| Class | Surfactants |
| Function | Surfactant, Resins, Stabilizer, Metalworking Fluids, Additive, Lubricant |
| Industry | Epoxy Resins |