Guazatine
Product Description
| Product | Guazatine |
| CAS | 108173-90-6 |
| Formula | C18H41N7 |
| Synonym | Guazatine |
Typical Product Specifications
| SMILES | [*] |
| Molecular weight | 333.23 |
| SMILES | N(c1ccccc1)(S(N(C)C)(=O)=O)SC(F)(Cl)Cl |
| InChI | 1S/C9H11Cl2FN2O2S2/c1-13(2)18(15,16)14(17-9(10,11)12)8-6-4-3-5-7-8/h3-7H,1-2H3 |
| Atmospheric OH Rate Constant | 1.49E-11 cm3/molecule-sec |
| log P (octanol-water) | 3.7 |
| Melting Point | 106 ° C |
| Water solubility | 1.3 mg/L |
| Henry's Law Constant | 3.78E-08 atm-m3/mole |
| Vapor Pressure | 1.12E-07 mm Hg |
| Notes | Guazatine uses and applications include: Fungicide, repellent Guazatineis a |
| Class | Amines |
| Function | Preservative |
| Industry | Agricultural |

Find another Material
Enter a chemical name, synonym or CAS# below





