| Molecular weight | 174.28 |
| EINECS | 238-126-5 |
| SMILES | C([C@@H](CC)CCCC)(OC)OC |
| Molecular weight | 256.34 |
| EINECS | 205-547-0 |
| SMILES | C(CNC(=S)[S-])NC(=S)[S-].[Na+].[Na+] |
| log P (octanol-water) | -4.240 |
| Vapor Pressure | 9.48E-13 mm Hg |
| Henry's Law Constant | 1.60E-18 atm-m3/mole |
| Atmospheric OH Rate Constant | 1.47E-10 cm3/molecule-sec |
| Water solubility | 2.00E+05 mg/L |
| Molecular weight | 388.20 |
| EINECS | 215-811-7 |
| SMILES | c1cc(c(cc1[N+](=O)[O-])Cl)NC(=O)c2cc(ccc2O)Cl.C(CO)N |
| Stability | Stable. Hydrolyzes in concentrated acidic or basic solutions. |
| Water solubility | 100 mg/L |
| Vapor Pressure | 1.00E-14 mm Hg |
| Melting Point | 216 ° C |
| Atmospheric OH Rate Constant | 2.10E-11 cm3/molecule-sec |
| log P (octanol-water) | 0.680 |
| Henry's Law Constant | 4.30E-20 atm-m3/mole |
| Chemical Structure |  |
| Notes | 2-Ethylhexanal dimethylacetal uses and applications include: Flavoring agent |
| Class | Specialty Chemicals, Water Treatment |
| Function | Antimicrobial, Biocide, Flavor |
| Industry | Industrial, Water Treatment, Flavor |