bromo(fluoro)methane
Product Description
| Product | bromo(fluoro)methane |
| CAS | 373-52-4 |
| Formula | CH2BrF |
| Synonym | Bromofluoromethane, BROMOFLUOROMETHANE-PYRIDINIUM ADDUCT, Bromofluoromethane 98%, Bromofluoromethane98%, BROMOFLUOROMETHANE-PYRIDINIUM ADDUCT: 99.8% (QUANTITIES PER ACTIVE INGREDIENT), Fluorobromomethane, Fluoromethyl bromide, BroMofluoroMethane [in solution or in cylinder (gas)], Methane, broMofluoro-(6CI,7CI,8CI,9CI), Bromofluoromethane |
Typical Product Specifications
| Molecular weight | 112.93 |
| SMILES | C(F)Br |
| InChI | 1S/CH2BrF/c2-1-3/h1H2 |
| log P (octanol-water) | 1.120 |
| Atmospheric OH Rate Constant | 2.46E-14 cm3/molecule-sec |
| Boiling Point | 19 ° C |
| Boiling Point | 17-18°C |
| Density | 1,76 g/cm3 |
| Flash Point | None |
| Molecular weight | 248.28 |
| EINECS | 212-668-2 |
| SMILES | c12c(\N=N\c3ccccc3)c(ccc1cccc2)O |
| InChI | 1S/C16H12N2O/c19-15-11-10-12-6-4-5-9-14(12)16(15)18-17-13-7-2-1-3-8-13/h1-11,19H |
| Melting Point | 131-133 °C |
| Stability | Incompatible with strong oxidizing agents. |
| Storage Temperature | Amber Vial, Refrigerator, Under Inert Atmosphere |
| Water solubility | 0.5 g/L (30 ºC) |
| Colour Index | 12055 |
| log P (octanol-water) | 5.510 |
| Water solubility | 0.674 mg/L |
| Vapor Pressure | 7.34E-08 mm Hg |
| Atmospheric OH Rate Constant | 1.83E-11 cm3/molecule-sec |
| Henry's Law Constant | 2.62E-11 atm-m3/mole |
| Melting Point | 134 ° C |
| Form | Powder |
| Color | Orange to red or brown |
| Class | Specialty Chemicals, Solvents, Solvent |
| Function | Solvents, Resins |
| Industry | Plastics, Solvents |
Find another Material
Enter a chemical name, synonym or CAS# below
