2,4-Ditert-Butyl-Phenol
Product Description
| Product | 2,4-Ditert-Butyl-Phenol |
| CAS | 96-76-4 |
| Formula | C14H22O |
| Synonym | 1-Hydroxy-2,4-di-tert-butylbenzene, 2,4-Di-tert-butylphenol, 2,4-di(1,1-dimethylethyl)-pheno, 24DTBP, Antioxidant No. 33, Prodox 146A-85X, antioxidantno.33, Phenol, 2,4-bis(1,1-dimethylethyl)-, 2,4-bis(1,1-dimethylethyl)-pheno, 2,4-bis(1,1'-dimethylethyl)phenol, Phenol, 2,4-di-tert-butyl-, 2,4-di-t-Butylphenol, Prodox 146, NSC 174502, 2,4-di-tert-butyl-pheno, 2,4-Bis(1,1-dimethylethyl)phenol, 2,4-Bis(tert-butyl)phenol, 2,4-tert-butylphenol |
Typical Product Specifications
| Flash Point | 239 °F |
| Boiling Point | 265 °C |
| Melting Point | 53-56 °C |
| Water solubility | practically insoluble |
| Vapor Pressure | 1 mm Hg ( 84.5 °C) |
| BRN Number | 1910383 |
| Stability | Stable. Combustible. Incompatible with acid chlorides, oxidizing agents, acid anhydrides, copper, copper alloys, bases, brass. |
| Molecular weight | 206.32 |
| EINECS | 202-532-0 |
| SMILES | CC(C)(C)c1ccc(O)c(c1)C(C)(C)C |
| InChI | 1S/C14H22O/c1-13(2,3)10-7-8-12(15)11(9-10)14(4,5)6/h7-9,15H,1-6H3 |
| Density | 0.887 |
| Notes | 2,4-Ditert-Butyl-Phenol uses and applications include: Antioxidant; intermediate; stabilizer; germicide |
| Class | Specialty Chemicals |
| Function | Stabilizer |
| Industry | Industrial, Organics |
Find another Material
Enter a chemical name, synonym or CAS# below
